About spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane]
spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] (PubChem CID 23253002) has the molecular formula C8H8O
and a molecular weight of 120.15 g/mol. Its IUPAC name is spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane].
Molecular Properties
| Compound Name | spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] |
| PubChem CID | 23253002 |
| Molecular Formula | C8H8O |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] |
| SMILES | C1OC12C1C3C1C1C3C12 |
| InChI | InChI=1S/C8H8O/c1-8(9-1)6-2-3(6)5-4(2)7(5)8/h2-7H,1H2 |
| InChIKey | PRHKKJKMKDZQMC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane]?
The IUPAC name of spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] (CID 23253002) is spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane].
What is the SMILES notation for spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane]?
The canonical SMILES for spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] is C1OC12C1C3C1C1C3C12.
What is the InChIKey of spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane]?
The InChIKey is PRHKKJKMKDZQMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O/c1-8(9-1)6-2-3(6)5-4(2)7(5)8/h2-7H,1H2.
What are the key properties of spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane]?
spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] has a molecular weight of 120.15 g/mol, XLogP of 0.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[oxirane-2,3'-tetracyclo[3.2.0.02,7.04,6]heptane] is sourced from PubChem (CID 23253002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).