C30H62O4S2Si2 — CID 23253282
methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate (PubChem CID 23253282) has the molecular formula C30H62O4S2Si2 and a molecular weight of 607.13 g/mol. Its IUPAC name is methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate.
| Compound Name | methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate |
|---|---|
| PubChem CID | 23253282 |
| Molecular Formula | C30H62O4S2Si2 |
| Molecular Weight | 607.13 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | methyl (2R,3S,4S,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-[2-[(3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylbutyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C1(CC[C@H](C)CO[Si](C)(C)C(C)(C)C)SCCS1 |
| InChI | InChI=1S/C30H62O4S2Si2/c1-22(21-33-37(12,13)28(5,6)7)16-17-30(35-18-19-36-30)24(3)20-23(2)26(25(4)27(31)32-11)34-38(14,15)29(8,9)10/h22-26H,16-21H2,1-15H3/t22-,23-,24+,25+,26-/m0/s1 |
| InChIKey | RJANDADZTBMMPP-DQUFFZNGSA-N |
| XLogP | 9.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.13 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|