C17H28O5 — CID 23253326
methyl (2R)-2-[(2S,3S,5S,6S,8R)-8-ethyl-3,5-dimethyl-9-oxo-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate (PubChem CID 23253326) has the molecular formula C17H28O5 and a molecular weight of 312.41 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3S,5S,6S,8R)-8-ethyl-3,5-dimethyl-9-oxo-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2S,3S,5S,6S,8R)-8-ethyl-3,5-dimethyl-9-oxo-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate |
|---|---|
| PubChem CID | 23253326 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methyl (2R)-2-[(2S,3S,5S,6S,8R)-8-ethyl-3,5-dimethyl-9-oxo-1,7-dioxaspiro[5.5]undecan-2-yl]propanoate |
| SMILES | CC[C@H]1O[C@]2(CCC1=O)O[C@H]([C@@H](C)C(=O)OC)[C@@H](C)C[C@@H]2C |
| InChI | InChI=1S/C17H28O5/c1-6-14-13(18)7-8-17(21-14)11(3)9-10(2)15(22-17)12(4)16(19)20-5/h10-12,14-15H,6-9H2,1-5H3/t10-,11-,12+,14+,15-,17+/m0/s1 |
| InChIKey | BCYAGWAMIFSJLL-PJMVSJCLSA-N |
| XLogP | 2.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |