C20H38O4S2 — CID 23253333
methyl (2R,3S,4S,6R)-3-hydroxy-6-[2-[(3R,4R)-4-hydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate (PubChem CID 23253333) has the molecular formula C20H38O4S2 and a molecular weight of 406.65 g/mol. Its IUPAC name is methyl (2R,3S,4S,6R)-3-hydroxy-6-[2-[(3R,4R)-4-hydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate.
| Compound Name | methyl (2R,3S,4S,6R)-3-hydroxy-6-[2-[(3R,4R)-4-hydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate |
|---|---|
| PubChem CID | 23253333 |
| Molecular Formula | C20H38O4S2 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | methyl (2R,3S,4S,6R)-3-hydroxy-6-[2-[(3R,4R)-4-hydroxy-3-methylhexyl]-1,3-dithiolan-2-yl]-2,4-dimethylheptanoate |
| SMILES | CC[C@@H](O)[C@H](C)CCC1([C@H](C)C[C@H](C)[C@H](O)[C@@H](C)C(=O)OC)SCCS1 |
| InChI | InChI=1S/C20H38O4S2/c1-7-17(21)13(2)8-9-20(25-10-11-26-20)15(4)12-14(3)18(22)16(5)19(23)24-6/h13-18,21-22H,7-12H2,1-6H3/t13-,14+,15-,16-,17-,18+/m1/s1 |
| InChIKey | QNDIZBMREFUAMN-HVKXIDHRSA-N |
| XLogP | 4.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |