About (2R,5S)-5-methyloxolan-2-ol
(2R,5S)-5-methyloxolan-2-ol (PubChem CID 23253384) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is (2R,5S)-5-methyloxolan-2-ol.
Molecular Properties
| Compound Name | (2R,5S)-5-methyloxolan-2-ol |
| PubChem CID | 23253384 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | (2R,5S)-5-methyloxolan-2-ol |
| SMILES | C[C@H]1CC[C@H](O)O1 |
| InChI | InChI=1S/C5H10O2/c1-4-2-3-5(6)7-4/h4-6H,2-3H2,1H3/t4-,5+/m0/s1 |
| InChIKey | ZHDOFGHVOHPUIL-CRCLSJGQSA-N |
| XLogP | 0.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,5S)-5-methyloxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-5-methyloxolan-2-ol?
The IUPAC name of (2R,5S)-5-methyloxolan-2-ol (CID 23253384) is (2R,5S)-5-methyloxolan-2-ol.
What is the SMILES notation for (2R,5S)-5-methyloxolan-2-ol?
The canonical SMILES for (2R,5S)-5-methyloxolan-2-ol is C[C@H]1CC[C@H](O)O1.
What is the InChIKey of (2R,5S)-5-methyloxolan-2-ol?
The InChIKey is ZHDOFGHVOHPUIL-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H10O2/c1-4-2-3-5(6)7-4/h4-6H,2-3H2,1H3/t4-,5+/m0/s1.
What are the key properties of (2R,5S)-5-methyloxolan-2-ol?
(2R,5S)-5-methyloxolan-2-ol has a molecular weight of 102.13 g/mol, XLogP of 0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-5-methyloxolan-2-ol is sourced from PubChem (CID 23253384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).