C18H36O2Si — CID 23253472
(4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dien-1-ol (PubChem CID 23253472) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dien-1-ol.
| Compound Name | (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dien-1-ol |
|---|---|
| PubChem CID | 23253472 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (4E,8E)-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dien-1-ol |
| SMILES | C/C(=C\CCCO)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O2Si/c1-16(11-8-9-14-19)12-10-13-17(2)15-20-21(6,7)18(3,4)5/h11,13,19H,8-10,12,14-15H2,1-7H3/b16-11+,17-13+ |
| InChIKey | AZZXGXBHZXKNJZ-IUBLYSDUSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|