C21H34O3Si — CID 23253672
(2Z,3R,3aR,7aS)-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3-triethylsilyloxy-7,7a-dihydro-3aH-1-benzofuran-4-one (PubChem CID 23253672) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (2Z,3R,3aR,7aS)-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3-triethylsilyloxy-7,7a-dihydro-3aH-1-benzofuran-4-one.
| Compound Name | (2Z,3R,3aR,7aS)-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3-triethylsilyloxy-7,7a-dihydro-3aH-1-benzofuran-4-one |
|---|---|
| PubChem CID | 23253672 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (2Z,3R,3aR,7aS)-3,6-dimethyl-2-(3-methylbut-2-enylidene)-3-triethylsilyloxy-7,7a-dihydro-3aH-1-benzofuran-4-one |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)/C(=C/C=C(C)C)O[C@H]2CC(C)=CC(=O)[C@H]21 |
| InChI | InChI=1S/C21H34O3Si/c1-8-25(9-2,10-3)24-21(7)19(12-11-15(4)5)23-18-14-16(6)13-17(22)20(18)21/h11-13,18,20H,8-10,14H2,1-7H3/b19-12-/t18-,20+,21-/m0/s1 |
| InChIKey | IHFCDSZFVCXTEG-OZFQWXBBSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|