C17H14Br2N2O7S — CID 23253678
methyl (2S,3R,6R,7R)-3-bromo-3-(bromomethyl)-7-(1,3-dioxoisoindol-2-yl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 23253678) has the molecular formula C17H14Br2N2O7S and a molecular weight of 550.18 g/mol. Its IUPAC name is methyl (2S,3R,6R,7R)-3-bromo-3-(bromomethyl)-7-(1,3-dioxoisoindol-2-yl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | methyl (2S,3R,6R,7R)-3-bromo-3-(bromomethyl)-7-(1,3-dioxoisoindol-2-yl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 23253678 |
| Molecular Formula | C17H14Br2N2O7S |
| Molecular Weight | 550.18 g/mol |
| Exact Mass | 547.89 |
| IUPAC Name | methyl (2S,3R,6R,7R)-3-bromo-3-(bromomethyl)-7-(1,3-dioxoisoindol-2-yl)-5,5,8-trioxo-5λ6-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1N2C(=O)[C@@H](N3C(=O)c4ccccc4C3=O)[C@H]2S(=O)(=O)C[C@@]1(Br)CBr |
| InChI | InChI=1S/C17H14Br2N2O7S/c1-28-16(25)11-17(19,6-18)7-29(26,27)15-10(14(24)21(11)15)20-12(22)8-4-2-3-5-9(8)13(20)23/h2-5,10-11,15H,6-7H2,1H3/t10-,11+,15-,17+/m1/s1 |
| InChIKey | UEMBFKKAINIBEK-ROIUPPMCSA-N |
| XLogP | 0.32 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|