About imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium
imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium (PubChem CID 23253812) has the molecular formula C15H23N2O+
and a molecular weight of 247.36 g/mol. Its IUPAC name is imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium.
Molecular Properties
| Compound Name | imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium |
| PubChem CID | 23253812 |
| Molecular Formula | C15H23N2O+ |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium |
| SMILES | CC1=CCC2(CC1)C(=O)C(=[N+]=N)CCCC2(C)C |
| InChI | InChI=1S/C15H23N2O/c1-11-6-9-15(10-7-11)13(18)12(17-16)5-4-8-14(15,2)3/h6,16H,4-5,7-10H2,1-3H3/q+1 |
| InChIKey | FHVQILSYFBVESQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium?
The IUPAC name of imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium (CID 23253812) is imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium.
What is the SMILES notation for imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium?
The canonical SMILES for imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium is CC1=CCC2(CC1)C(=O)C(=[N+]=N)CCCC2(C)C.
What is the InChIKey of imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium?
The InChIKey is FHVQILSYFBVESQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N2O/c1-11-6-9-15(10-7-11)13(18)12(17-16)5-4-8-14(15,2)3/h6,16H,4-5,7-10H2,1-3H3/q+1.
What are the key properties of imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium?
imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium has a molecular weight of 247.36 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for imino-(3,12,12-trimethyl-7-oxospiro[5.6]dodec-3-en-8-ylidene)azanium is sourced from PubChem (CID 23253812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).