About CID 23253827
CID 23253827 (PubChem CID 23253827) has the molecular formula C25H42O4Si
and a molecular weight of 434.69 g/mol.
Molecular Properties
| Compound Name | CID 23253827 |
| PubChem CID | 23253827 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H]1CCC[C@@H]2CC3(CC[C@]2(C)[C@@]12CC=C(C[Si](C)(C)C)CC2)OCCO3 |
| InChI | InChI=1S/C25H42O4Si/c1-23-13-14-25(28-15-16-29-25)17-20(23)7-6-8-21(22(26)27-2)24(23)11-9-19(10-12-24)18-30(3,4)5/h9,20-21H,6-8,10-18H2,1-5H3/t20-,21+,23+,24-/m1/s1 |
| InChIKey | WOLVNYJHDCIWOM-AWAHEQQVSA-N |
| XLogP | 5.94 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 23253827 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23253827?
The IUPAC name of CID 23253827 (CID 23253827) is not available.
What is the SMILES notation for CID 23253827?
The canonical SMILES for CID 23253827 is COC(=O)[C@@H]1CCC[C@@H]2CC3(CC[C@]2(C)[C@@]12CC=C(C[Si](C)(C)C)CC2)OCCO3.
What is the InChIKey of CID 23253827?
The InChIKey is WOLVNYJHDCIWOM-AWAHEQQVSA-N. The full InChI is InChI=1S/C25H42O4Si/c1-23-13-14-25(28-15-16-29-25)17-20(23)7-6-8-21(22(26)27-2)24(23)11-9-19(10-12-24)18-30(3,4)5/h9,20-21H,6-8,10-18H2,1-5H3/t20-,21+,23+,24-/m1/s1.
What are the key properties of CID 23253827?
CID 23253827 has a molecular weight of 434.69 g/mol, XLogP of 5.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23253827 is sourced from PubChem (CID 23253827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).