C25H44O5Si — CID 23254066
methyl (1R,2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2-(5-methoxy-5-oxopentyl)-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 23254066) has the molecular formula C25H44O5Si and a molecular weight of 452.71 g/mol. Its IUPAC name is methyl (1R,2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2-(5-methoxy-5-oxopentyl)-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2-(5-methoxy-5-oxopentyl)-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 23254066 |
| Molecular Formula | C25H44O5Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | methyl (1R,2R,4aS,5R,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-2-(5-methoxy-5-oxopentyl)-1-methyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)CCCC[C@@H]1C=C[C@H]2[C@@H](CCC[C@H]2O[Si](C)(C)C(C)(C)C)[C@]1(C)C(=O)OC |
| InChI | InChI=1S/C25H44O5Si/c1-24(2,3)31(7,8)30-21-14-11-13-20-19(21)17-16-18(25(20,4)23(27)29-6)12-9-10-15-22(26)28-5/h16-21H,9-15H2,1-8H3/t18-,19+,20-,21-,25-/m1/s1 |
| InChIKey | GEAAWFACMYCGOZ-QNFRPBLGSA-N |
| XLogP | 5.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|