About ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate
ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate (PubChem CID 2325451) has the molecular formula C11H16N2O3S
and a molecular weight of 256.33 g/mol. Its IUPAC name is ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate |
| PubChem CID | 2325451 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate |
| SMILES | CCOC(=O)Cc1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C11H16N2O3S/c1-2-16-10(14)7-9-8-17-11(12-9)13-3-5-15-6-4-13/h8H,2-7H2,1H3 |
| InChIKey | NDZOLYPESIETMS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate?
The IUPAC name of ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate (CID 2325451) is ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate.
What is the SMILES notation for ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate?
The canonical SMILES for ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate is CCOC(=O)Cc1csc(N2CCOCC2)n1.
What is the InChIKey of ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate?
The InChIKey is NDZOLYPESIETMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S/c1-2-16-10(14)7-9-8-17-11(12-9)13-3-5-15-6-4-13/h8H,2-7H2,1H3.
What are the key properties of ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate?
ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate has a molecular weight of 256.33 g/mol, XLogP of 1.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-morpholin-4-yl-1,3-thiazol-4-yl)acetate is sourced from PubChem (CID 2325451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).