About 2-methylsulfanyl-3,4-diphenylthiophene
2-methylsulfanyl-3,4-diphenylthiophene (PubChem CID 23254570) has the molecular formula C17H14S2
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-methylsulfanyl-3,4-diphenylthiophene.
Molecular Properties
| Compound Name | 2-methylsulfanyl-3,4-diphenylthiophene |
| PubChem CID | 23254570 |
| Molecular Formula | C17H14S2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 2-methylsulfanyl-3,4-diphenylthiophene |
| SMILES | CSc1scc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H14S2/c1-18-17-16(14-10-6-3-7-11-14)15(12-19-17)13-8-4-2-5-9-13/h2-12H,1H3 |
| InChIKey | TZTYUHUUXSQUFU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylsulfanyl-3,4-diphenylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanyl-3,4-diphenylthiophene?
The IUPAC name of 2-methylsulfanyl-3,4-diphenylthiophene (CID 23254570) is 2-methylsulfanyl-3,4-diphenylthiophene.
What is the SMILES notation for 2-methylsulfanyl-3,4-diphenylthiophene?
The canonical SMILES for 2-methylsulfanyl-3,4-diphenylthiophene is CSc1scc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-methylsulfanyl-3,4-diphenylthiophene?
The InChIKey is TZTYUHUUXSQUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14S2/c1-18-17-16(14-10-6-3-7-11-14)15(12-19-17)13-8-4-2-5-9-13/h2-12H,1H3.
What are the key properties of 2-methylsulfanyl-3,4-diphenylthiophene?
2-methylsulfanyl-3,4-diphenylthiophene has a molecular weight of 282.43 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanyl-3,4-diphenylthiophene is sourced from PubChem (CID 23254570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).