C15H26O2S2 — CID 23254597
2-[3-(2-pent-4-enyl-1,3-dithian-2-yl)propyl]-1,3-dioxolane (PubChem CID 23254597) has the molecular formula C15H26O2S2 and a molecular weight of 302.50 g/mol. Its IUPAC name is 2-[3-(2-pent-4-enyl-1,3-dithian-2-yl)propyl]-1,3-dioxolane.
| Compound Name | 2-[3-(2-pent-4-enyl-1,3-dithian-2-yl)propyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 23254597 |
| Molecular Formula | C15H26O2S2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[3-(2-pent-4-enyl-1,3-dithian-2-yl)propyl]-1,3-dioxolane |
| SMILES | C=CCCCC1(CCCC2OCCO2)SCCCS1 |
| InChI | InChI=1S/C15H26O2S2/c1-2-3-4-8-15(18-12-6-13-19-15)9-5-7-14-16-10-11-17-14/h2,14H,1,3-13H2 |
| InChIKey | BCHWDZONUORDPU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|