C17H30O4S2 — CID 23254617
2-[3-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]propyl]-1,3-dioxolane (PubChem CID 23254617) has the molecular formula C17H30O4S2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 2-[3-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]propyl]-1,3-dioxolane.
| Compound Name | 2-[3-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]propyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 23254617 |
| Molecular Formula | C17H30O4S2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[3-[2-[4-(1,3-dioxolan-2-yl)butyl]-1,3-dithian-2-yl]propyl]-1,3-dioxolane |
| SMILES | C1CSC(CCCCC2OCCO2)(CCCC2OCCO2)SC1 |
| InChI | InChI=1S/C17H30O4S2/c1(5-15-18-9-10-19-15)2-7-17(22-13-4-14-23-17)8-3-6-16-20-11-12-21-16/h15-16H,1-14H2 |
| InChIKey | WMWXOYZIPGXJGH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|