C10H24O3Si — CID 23254662
(2R,3R)-1-[tert-butyl(dimethyl)silyl]oxybutane-2,3-diol (PubChem CID 23254662) has the molecular formula C10H24O3Si and a molecular weight of 220.38 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxybutane-2,3-diol.
| Compound Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxybutane-2,3-diol |
|---|---|
| PubChem CID | 23254662 |
| Molecular Formula | C10H24O3Si |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(dimethyl)silyl]oxybutane-2,3-diol |
| SMILES | C[C@@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C10H24O3Si/c1-8(11)9(12)7-13-14(5,6)10(2,3)4/h8-9,11-12H,7H2,1-6H3/t8-,9-/m1/s1 |
| InChIKey | YXVBNSDTGZWVOC-RKDXNWHRSA-N |
| XLogP | 1.75 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|