C12H22O2Si — CID 23254712
tert-butyl-dimethyl-(7-oxabicyclo[2.2.1]hept-2-en-2-yloxy)silane (PubChem CID 23254712) has the molecular formula C12H22O2Si and a molecular weight of 226.39 g/mol. Its IUPAC name is tert-butyl-dimethyl-(7-oxabicyclo[2.2.1]hept-2-en-2-yloxy)silane.
| Compound Name | tert-butyl-dimethyl-(7-oxabicyclo[2.2.1]hept-2-en-2-yloxy)silane |
|---|---|
| PubChem CID | 23254712 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | tert-butyl-dimethyl-(7-oxabicyclo[2.2.1]hept-2-en-2-yloxy)silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC2CCC1O2 |
| InChI | InChI=1S/C12H22O2Si/c1-12(2,3)15(4,5)14-11-8-9-6-7-10(11)13-9/h8-10H,6-7H2,1-5H3 |
| InChIKey | CBVGBHMDZRXJBZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|