C12H22O3Si — CID 23254717
(1R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]heptan-2-one (PubChem CID 23254717) has the molecular formula C12H22O3Si and a molecular weight of 242.39 g/mol. Its IUPAC name is (1R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 23254717 |
| Molecular Formula | C12H22O3Si |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-7-oxabicyclo[2.2.1]heptan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C(=O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C12H22O3Si/c1-12(2,3)16(4,5)15-11-9-7-6-8(14-9)10(11)13/h8-9,11H,6-7H2,1-5H3/t8-,9+,11-/m1/s1 |
| InChIKey | VIYCLHUTVIIRAO-WCABBAIRSA-N |
| XLogP | 2.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|