C38H48N6O2Si2 — CID 23254754
tert-butyl-[(2R,5R)-2,5-diazido-6-[tert-butyl(diphenyl)silyl]oxyhexoxy]-diphenylsilane (PubChem CID 23254754) has the molecular formula C38H48N6O2Si2 and a molecular weight of 677.01 g/mol. Its IUPAC name is tert-butyl-[(2R,5R)-2,5-diazido-6-[tert-butyl(diphenyl)silyl]oxyhexoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,5R)-2,5-diazido-6-[tert-butyl(diphenyl)silyl]oxyhexoxy]-diphenylsilane |
|---|---|
| PubChem CID | 23254754 |
| Molecular Formula | C38H48N6O2Si2 |
| Molecular Weight | 677.01 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | tert-butyl-[(2R,5R)-2,5-diazido-6-[tert-butyl(diphenyl)silyl]oxyhexoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H](CC[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N=[N+]=[N-])N=[N+]=[N-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H48N6O2Si2/c1-37(2,3)47(33-19-11-7-12-20-33,34-21-13-8-14-22-34)45-29-31(41-43-39)27-28-32(42-44-40)30-46-48(38(4,5)6,35-23-15-9-16-24-35)36-25-17-10-18-26-36/h7-26,31-32H,27-30H2,1-6H3/t31-,32-/m1/s1 |
| InChIKey | PTFQJCIQWJZFQA-ROJLCIKYSA-N |
| XLogP | 8.28 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.01 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|