C19H22O5S — CID 23255380
(1S,2S,3S,6S,7R)-5-ethoxy-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 23255380) has the molecular formula C19H22O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is (1S,2S,3S,6S,7R)-5-ethoxy-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1S,2S,3S,6S,7R)-5-ethoxy-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 23255380 |
| Molecular Formula | C19H22O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | (1S,2S,3S,6S,7R)-5-ethoxy-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | CCOC1=C(CS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@@H]2[C@H]1[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C19H22O5S/c1-3-23-19-13(10-25(21,22)12-6-4-11(2)5-7-12)18(20)16-14-8-9-15(24-14)17(16)19/h4-9,14-18,20H,3,10H2,1-2H3/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | QDEDRIVHFXNSOV-IGKNDFSCSA-N |
| XLogP | 2.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|