C17H18O4S — CID 23255381
(1S,2S,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol (PubChem CID 23255381) has the molecular formula C17H18O4S and a molecular weight of 318.39 g/mol. Its IUPAC name is (1S,2S,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol.
| Compound Name | (1S,2S,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
|---|---|
| PubChem CID | 23255381 |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (1S,2S,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)CC2=C[C@H]3[C@H]([C@@H]4C=C[C@H]3O4)[C@@H]2O)cc1 |
| InChI | InChI=1S/C17H18O4S/c1-10-2-4-12(5-3-10)22(19,20)9-11-8-13-14-6-7-15(21-14)16(13)17(11)18/h2-8,13-18H,9H2,1H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | PROVHPAVGATCRY-NQNKBUKLSA-N |
| XLogP | 1.64 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|