C19H20O5S — CID 23255382
[(1S,2R,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-yl] acetate (PubChem CID 23255382) has the molecular formula C19H20O5S and a molecular weight of 360.43 g/mol. Its IUPAC name is [(1S,2R,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-yl] acetate.
| Compound Name | [(1S,2R,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-yl] acetate |
|---|---|
| PubChem CID | 23255382 |
| Molecular Formula | C19H20O5S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [(1S,2R,3S,6S,7R)-4-[(4-methylphenyl)sulfonylmethyl]-10-oxatricyclo[5.2.1.02,6]deca-4,8-dien-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(CS(=O)(=O)c2ccc(C)cc2)=C[C@H]2[C@@H]1[C@@H]1C=C[C@H]2O1 |
| InChI | InChI=1S/C19H20O5S/c1-11-3-5-14(6-4-11)25(21,22)10-13-9-15-16-7-8-17(24-16)18(15)19(13)23-12(2)20/h3-9,15-19H,10H2,1-2H3/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | LMPYFMJKMVLNBQ-UJWQCDCRSA-N |
| XLogP | 2.21 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|