C29H27BrO10 — CID 23255606
dimethyl 4-[[3-[[3,4-bis(methoxycarbonyl)phenyl]methoxy]-5-(bromomethyl)phenoxy]methyl]benzene-1,2-dicarboxylate (PubChem CID 23255606) has the molecular formula C29H27BrO10 and a molecular weight of 615.43 g/mol. Its IUPAC name is dimethyl 4-[[3-[[3,4-bis(methoxycarbonyl)phenyl]methoxy]-5-(bromomethyl)phenoxy]methyl]benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-[[3-[[3,4-bis(methoxycarbonyl)phenyl]methoxy]-5-(bromomethyl)phenoxy]methyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23255606 |
| Molecular Formula | C29H27BrO10 |
| Molecular Weight | 615.43 g/mol |
| Exact Mass | 614.08 |
| IUPAC Name | dimethyl 4-[[3-[[3,4-bis(methoxycarbonyl)phenyl]methoxy]-5-(bromomethyl)phenoxy]methyl]benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(COc2cc(CBr)cc(OCc3ccc(C(=O)OC)c(C(=O)OC)c3)c2)cc1C(=O)OC |
| InChI | InChI=1S/C29H27BrO10/c1-35-26(31)22-7-5-17(11-24(22)28(33)37-3)15-39-20-9-19(14-30)10-21(13-20)40-16-18-6-8-23(27(32)36-2)25(12-18)29(34)38-4/h5-13H,14-16H2,1-4H3 |
| InChIKey | DYRZAJWPRORKJG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|