C17H22O7 — CID 23255791
[(1S,2R,4R,8R,10R,12S,14R)-14-hydroxy-7-methyl-11-methylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-2-yl]methyl acetate (PubChem CID 23255791) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is [(1S,2R,4R,8R,10R,12S,14R)-14-hydroxy-7-methyl-11-methylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-2-yl]methyl acetate.
| Compound Name | [(1S,2R,4R,8R,10R,12S,14R)-14-hydroxy-7-methyl-11-methylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23255791 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(1S,2R,4R,8R,10R,12S,14R)-14-hydroxy-7-methyl-11-methylidene-6-oxo-5,13,15-trioxatetracyclo[10.2.1.02,10.04,8]pentadecan-2-yl]methyl acetate |
| SMILES | C=C1[C@@H]2O[C@@H](O)[C@@H](O2)[C@]2(COC(C)=O)C[C@H]3OC(=O)C(C)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C17H22O7/c1-7-10-4-11-8(2)16-23-13(15(20)24-16)17(11,6-21-9(3)18)5-12(10)22-14(7)19/h7,10-13,15-16,20H,2,4-6H2,1,3H3/t7?,10-,11+,12-,13-,15-,16+,17+/m1/s1 |
| InChIKey | CQFYGPYYWAUKKU-SGLOJANRSA-N |
| XLogP | 0.75 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|