About 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane
2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane (PubChem CID 23255796) has the molecular formula C7H15Cl3Se
and a molecular weight of 284.52 g/mol. Its IUPAC name is 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane.
Molecular Properties
| Compound Name | 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane |
| PubChem CID | 23255796 |
| Molecular Formula | C7H15Cl3Se |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 283.94 |
| IUPAC Name | 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane |
| SMILES | CC(C)(C)C(Cl)C[Se](C)(Cl)Cl |
| InChI | InChI=1S/C7H15Cl3Se/c1-7(2,3)6(8)5-11(4,9)10/h6H,5H2,1-4H3 |
| InChIKey | NWFFZAVBKBWDAS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane?
The IUPAC name of 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane (CID 23255796) is 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane.
What is the SMILES notation for 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane?
The canonical SMILES for 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane is CC(C)(C)C(Cl)C[Se](C)(Cl)Cl.
What is the InChIKey of 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane?
The InChIKey is NWFFZAVBKBWDAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15Cl3Se/c1-7(2,3)6(8)5-11(4,9)10/h6H,5H2,1-4H3.
What are the key properties of 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane?
2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane has a molecular weight of 284.52 g/mol, XLogP of 4.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1-[dichloro(methyl)-λ4-selanyl]-3,3-dimethylbutane is sourced from PubChem (CID 23255796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).