About 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione
4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione (PubChem CID 2325588) has the molecular formula C7H10O2S5
and a molecular weight of 286.49 g/mol. Its IUPAC name is 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione.
Molecular Properties
| Compound Name | 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione |
| PubChem CID | 2325588 |
| Molecular Formula | C7H10O2S5 |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 285.93 |
| IUPAC Name | 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione |
| SMILES | OCCSc1sc(=S)sc1SCCO |
| InChI | InChI=1S/C7H10O2S5/c8-1-3-11-5-6(12-4-2-9)14-7(10)13-5/h8-9H,1-4H2 |
| InChIKey | UTMMADNPHWSIIH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione?
The IUPAC name of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione (CID 2325588) is 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione.
What is the SMILES notation for 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione?
The canonical SMILES for 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione is OCCSc1sc(=S)sc1SCCO.
What is the InChIKey of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione?
The InChIKey is UTMMADNPHWSIIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2S5/c8-1-3-11-5-6(12-4-2-9)14-7(10)13-5/h8-9H,1-4H2.
What are the key properties of 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione?
4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione has a molecular weight of 286.49 g/mol, XLogP of 2.71, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(2-hydroxyethylsulfanyl)-1,3-dithiole-2-thione is sourced from PubChem (CID 2325588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).