C19H21BrO3 — CID 23255971
[(1R,3Z,5S,8Z,12R)-13-oxabicyclo[10.1.0]trideca-3,8-dien-5-yl] 4-bromobenzoate (PubChem CID 23255971) has the molecular formula C19H21BrO3 and a molecular weight of 377.28 g/mol. Its IUPAC name is [(1R,3Z,5S,8Z,12R)-13-oxabicyclo[10.1.0]trideca-3,8-dien-5-yl] 4-bromobenzoate.
| Compound Name | [(1R,3Z,5S,8Z,12R)-13-oxabicyclo[10.1.0]trideca-3,8-dien-5-yl] 4-bromobenzoate |
|---|---|
| PubChem CID | 23255971 |
| Molecular Formula | C19H21BrO3 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(1R,3Z,5S,8Z,12R)-13-oxabicyclo[10.1.0]trideca-3,8-dien-5-yl] 4-bromobenzoate |
| SMILES | O=C(O[C@@H]1/C=C\C[C@H]2O[C@@H]2CC/C=C\CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrO3/c20-15-12-10-14(11-13-15)19(21)22-16-6-3-1-2-4-8-17-18(23-17)9-5-7-16/h1-2,5,7,10-13,16-18H,3-4,6,8-9H2/b2-1-,7-5-/t16-,17+,18+/m0/s1 |
| InChIKey | NQYMKBWRTAZBEC-YSLKMOJNSA-N |
| XLogP | 4.82 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|