C19H30O4 — CID 23255985
(2S,3S,8S)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 23255985) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2S,3S,8S)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | (2S,3S,8S)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 23255985 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2S,3S,8S)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CC1=CC2(CC(C)(C)[C@@]1(O)/C=C/C(C)=C\CO)O[C@@H](C)[C@H](C)O2 |
| InChI | InChI=1S/C19H30O4/c1-13(8-10-20)7-9-19(21)14(2)11-18(12-17(19,5)6)22-15(3)16(4)23-18/h7-9,11,15-16,20-21H,10,12H2,1-6H3/b9-7+,13-8-/t15-,16-,19+/m0/s1 |
| InChIKey | CSBVIDCWKYAQTQ-GNWIRAMQSA-N |
| XLogP | 3.11 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|