About [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate
[(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate (PubChem CID 23256085) has the molecular formula C7H12O5S
and a molecular weight of 208.23 g/mol. Its IUPAC name is [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate |
| PubChem CID | 23256085 |
| Molecular Formula | C7H12O5S |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate |
| SMILES | C[C@H]1C[C@@H](COS(C)(=O)=O)OC1=O |
| InChI | InChI=1S/C7H12O5S/c1-5-3-6(12-7(5)8)4-11-13(2,9)10/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| InChIKey | WUCZOMDYUFBFDM-WDSKDSINSA-N |
| XLogP | -0.09 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate?
The IUPAC name of [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate (CID 23256085) is [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate.
What is the SMILES notation for [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate?
The canonical SMILES for [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate is C[C@H]1C[C@@H](COS(C)(=O)=O)OC1=O.
What is the InChIKey of [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate?
The InChIKey is WUCZOMDYUFBFDM-WDSKDSINSA-N. The full InChI is InChI=1S/C7H12O5S/c1-5-3-6(12-7(5)8)4-11-13(2,9)10/h5-6H,3-4H2,1-2H3/t5-,6-/m0/s1.
What are the key properties of [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate?
[(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate has a molecular weight of 208.23 g/mol, XLogP of -0.09, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-4-methyl-5-oxooxolan-2-yl]methyl methanesulfonate is sourced from PubChem (CID 23256085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).