C20H24O7S — CID 23256135
[(1R,2R,6S,7S,8S,9S,12R)-4,4-dimethyl-11-oxo-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-yl]methyl 4-methylbenzenesulfonate (PubChem CID 23256135) has the molecular formula C20H24O7S and a molecular weight of 408.47 g/mol. Its IUPAC name is [(1R,2R,6S,7S,8S,9S,12R)-4,4-dimethyl-11-oxo-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,6S,7S,8S,9S,12R)-4,4-dimethyl-11-oxo-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23256135 |
| Molecular Formula | C20H24O7S |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | [(1R,2R,6S,7S,8S,9S,12R)-4,4-dimethyl-11-oxo-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)[C@@H]3[C@H]4C[C@H]([C@@H]5OC(C)(C)O[C@H]45)[C@@H]32)cc1 |
| InChI | InChI=1S/C20H24O7S/c1-10-4-6-11(7-5-10)28(22,23)24-9-14-15-12-8-13(16(15)19(21)25-14)18-17(12)26-20(2,3)27-18/h4-7,12-18H,8-9H2,1-3H3/t12-,13+,14+,15+,16+,17-,18+/m0/s1 |
| InChIKey | PDWSSRKKKFWAOW-DCIMDAQESA-N |
| XLogP | 2.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|