C13H17IO4 — CID 23256136
(1S,2S,6R,7R,8R,11S,12S)-11-(iodomethyl)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-one (PubChem CID 23256136) has the molecular formula C13H17IO4 and a molecular weight of 364.18 g/mol. Its IUPAC name is (1S,2S,6R,7R,8R,11S,12S)-11-(iodomethyl)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-one.
| Compound Name | (1S,2S,6R,7R,8R,11S,12S)-11-(iodomethyl)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-one |
|---|---|
| PubChem CID | 23256136 |
| Molecular Formula | C13H17IO4 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | (1S,2S,6R,7R,8R,11S,12S)-11-(iodomethyl)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.1.02,6.08,12]tridecan-9-one |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C[C@H]([C@@H]2O1)[C@H]1[C@@H]3C(=O)O[C@@H]1CI |
| InChI | InChI=1S/C13H17IO4/c1-13(2)17-10-5-3-6(11(10)18-13)9-8(5)7(4-14)16-12(9)15/h5-11H,3-4H2,1-2H3/t5-,6+,7+,8+,9+,10-,11+/m0/s1 |
| InChIKey | RYDTZIFAGUVKIZ-YGWHWJNPSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|