C14H20O4 — CID 23256137
methyl (1S,2S,6R,7R,8S,9S)-9-ethenyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 23256137) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl (1S,2S,6R,7R,8S,9S)-9-ethenyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | methyl (1S,2S,6R,7R,8S,9S)-9-ethenyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 23256137 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl (1S,2S,6R,7R,8S,9S)-9-ethenyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | C=C[C@H]1[C@@H]2C[C@@H]([C@H]3OC(C)(C)O[C@@H]23)[C@H]1C(=O)OC |
| InChI | InChI=1S/C14H20O4/c1-5-7-8-6-9(10(7)13(15)16-4)12-11(8)17-14(2,3)18-12/h5,7-12H,1,6H2,2-4H3/t7-,8-,9+,10-,11-,12+/m0/s1 |
| InChIKey | HGPPPGAQYYQMGR-ANNWIZPPSA-N |
| XLogP | 1.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|