C21H18N2O3S — CID 23256537
(1R,3S,3aS,6aR)-1,5-diphenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-thiolane]-2',4,6-trione (PubChem CID 23256537) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is (1R,3S,3aS,6aR)-1,5-diphenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-thiolane]-2',4,6-trione.
| Compound Name | (1R,3S,3aS,6aR)-1,5-diphenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-thiolane]-2',4,6-trione |
|---|---|
| PubChem CID | 23256537 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (1R,3S,3aS,6aR)-1,5-diphenylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-thiolane]-2',4,6-trione |
| SMILES | O=C1[C@H]2[C@H](c3ccccc3)N[C@@]3(CCSC3=O)[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H18N2O3S/c24-18-15-16(19(25)23(18)14-9-5-2-6-10-14)21(11-12-27-20(21)26)22-17(15)13-7-3-1-4-8-13/h1-10,15-17,22H,11-12H2/t15-,16-,17+,21+/m1/s1 |
| InChIKey | WSBOREJYCWWBNX-VWXURSGXSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|