C15H10ClN — CID 23256677
(10S,11R,13R)-11-chlorotetracyclo[7.4.1.05,14.010,13]tetradeca-1,3,5(14),6,8-pentaene-11-carbonitrile (PubChem CID 23256677) has the molecular formula C15H10ClN and a molecular weight of 239.71 g/mol. Its IUPAC name is (10S,11R,13R)-11-chlorotetracyclo[7.4.1.05,14.010,13]tetradeca-1,3,5(14),6,8-pentaene-11-carbonitrile.
| Compound Name | (10S,11R,13R)-11-chlorotetracyclo[7.4.1.05,14.010,13]tetradeca-1,3,5(14),6,8-pentaene-11-carbonitrile |
|---|---|
| PubChem CID | 23256677 |
| Molecular Formula | C15H10ClN |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | (10S,11R,13R)-11-chlorotetracyclo[7.4.1.05,14.010,13]tetradeca-1,3,5(14),6,8-pentaene-11-carbonitrile |
| SMILES | N#C[C@@]1(Cl)C[C@H]2c3cccc4cccc(c34)[C@H]21 |
| InChI | InChI=1S/C15H10ClN/c16-15(8-17)7-12-10-5-1-3-9-4-2-6-11(13(9)10)14(12)15/h1-6,12,14H,7H2/t12-,14+,15-/m0/s1 |
| InChIKey | UWNMORNGKRVOPU-CFVMTHIKSA-N |
| XLogP | 3.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|