C19H18N2O6S2 — CID 2325736
N-(1,3-benzodioxol-5-yl)-2-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylmethylsulfanyl]acetamide (PubChem CID 2325736) has the molecular formula C19H18N2O6S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylmethylsulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylmethylsulfanyl]acetamide |
|---|---|
| PubChem CID | 2325736 |
| Molecular Formula | C19H18N2O6S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl]sulfanylmethylsulfanyl]acetamide |
| SMILES | O=C(CSCSCC(=O)Nc1ccc2c(c1)OCO2)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18N2O6S2/c22-18(20-12-1-3-14-16(5-12)26-9-24-14)7-28-11-29-8-19(23)21-13-2-4-15-17(6-13)27-10-25-15/h1-6H,7-11H2,(H,20,22)(H,21,23) |
| InChIKey | KMBFHZSOXUCNDF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|