About 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile
4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile (PubChem CID 23257781) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile |
| PubChem CID | 23257781 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile |
| SMILES | N#CC1=CCC2C(=O)CCC12 |
| InChI | InChI=1S/C9H9NO/c10-5-6-1-2-8-7(6)3-4-9(8)11/h1,7-8H,2-4H2 |
| InChIKey | AQSZTEOIVWUMTG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile?
The IUPAC name of 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile (CID 23257781) is 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile.
What is the SMILES notation for 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile?
The canonical SMILES for 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile is N#CC1=CCC2C(=O)CCC12.
What is the InChIKey of 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile?
The InChIKey is AQSZTEOIVWUMTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c10-5-6-1-2-8-7(6)3-4-9(8)11/h1,7-8H,2-4H2.
What are the key properties of 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile?
4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile has a molecular weight of 147.18 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3a,5,6,6a-tetrahydro-3H-pentalene-1-carbonitrile is sourced from PubChem (CID 23257781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).