C19H20N4 — CID 23257800
14-tert-butyl-5,6-dimethyl-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene (PubChem CID 23257800) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 14-tert-butyl-5,6-dimethyl-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene.
| Compound Name | 14-tert-butyl-5,6-dimethyl-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene |
|---|---|
| PubChem CID | 23257800 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 14-tert-butyl-5,6-dimethyl-2,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene |
| SMILES | Cc1cc2nc3nc4cc(C(C)(C)C)ccn4c3nc2cc1C |
| InChI | InChI=1S/C19H20N4/c1-11-8-14-15(9-12(11)2)21-18-17(20-14)22-16-10-13(19(3,4)5)6-7-23(16)18/h6-10H,1-5H3 |
| InChIKey | VCCXULMTEAZGNY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |