C18H15FO2 — CID 23257924
(2Z,4E,6E)-7-azulen-1-yl-2-fluoro-3-methylhepta-2,4,6-trienoic acid (PubChem CID 23257924) has the molecular formula C18H15FO2 and a molecular weight of 282.31 g/mol. Its IUPAC name is (2Z,4E,6E)-7-azulen-1-yl-2-fluoro-3-methylhepta-2,4,6-trienoic acid.
| Compound Name | (2Z,4E,6E)-7-azulen-1-yl-2-fluoro-3-methylhepta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 23257924 |
| Molecular Formula | C18H15FO2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | (2Z,4E,6E)-7-azulen-1-yl-2-fluoro-3-methylhepta-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C/c1ccc2cccccc1-2)=C(/F)C(=O)O |
| InChI | InChI=1S/C18H15FO2/c1-13(17(19)18(20)21)7-5-6-9-15-12-11-14-8-3-2-4-10-16(14)15/h2-12H,1H3,(H,20,21)/b7-5+,9-6+,17-13- |
| InChIKey | GMOIUNOGGRBLDV-ZYGGPICOSA-N |
| XLogP | 4.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|