C24H22N2O2 — CID 23257930
(1R,8R,9R)-1-benzoyl-9-morpholin-4-yltricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraene-9-carbonitrile (PubChem CID 23257930) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1R,8R,9R)-1-benzoyl-9-morpholin-4-yltricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraene-9-carbonitrile.
| Compound Name | (1R,8R,9R)-1-benzoyl-9-morpholin-4-yltricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraene-9-carbonitrile |
|---|---|
| PubChem CID | 23257930 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (1R,8R,9R)-1-benzoyl-9-morpholin-4-yltricyclo[6.2.2.02,7]dodeca-2,4,6,11-tetraene-9-carbonitrile |
| SMILES | N#C[C@@]1(N2CCOCC2)C[C@@]2(C(=O)c3ccccc3)C=C[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C24H22N2O2/c25-17-24(26-12-14-28-15-13-26)16-23(22(27)18-6-2-1-3-7-18)11-10-21(24)19-8-4-5-9-20(19)23/h1-11,21H,12-16H2/t21-,23+,24+/m1/s1 |
| InChIKey | XADNJHWSHSIBQY-NHTMILBNSA-N |
| XLogP | 3.46 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|