About 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one
12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one (PubChem CID 23258029) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one.
Molecular Properties
| Compound Name | 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one |
| PubChem CID | 23258029 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one |
| SMILES | O=C1CCCCCCc2ccc1[nH]2 |
| InChI | InChI=1S/C11H15NO/c13-11-6-4-2-1-3-5-9-7-8-10(11)12-9/h7-8,12H,1-6H2 |
| InChIKey | LAGPTOBCYACTDT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one?
The IUPAC name of 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one (CID 23258029) is 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one.
What is the SMILES notation for 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one?
The canonical SMILES for 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one is O=C1CCCCCCc2ccc1[nH]2.
What is the InChIKey of 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one?
The InChIKey is LAGPTOBCYACTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c13-11-6-4-2-1-3-5-9-7-8-10(11)12-9/h7-8,12H,1-6H2.
What are the key properties of 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one?
12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one has a molecular weight of 177.25 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 12-azabicyclo[7.2.1]dodeca-1(11),9-dien-2-one is sourced from PubChem (CID 23258029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).