C21H30O4S — CID 23258116
2-[[(3S,8R,9S,10R,13S,14S,16R)-3-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]sulfanyl]acetic acid (PubChem CID 23258116) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is 2-[[(3S,8R,9S,10R,13S,14S,16R)-3-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[(3S,8R,9S,10R,13S,14S,16R)-3-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 23258116 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-[[(3S,8R,9S,10R,13S,14S,16R)-3-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-16-yl]sulfanyl]acetic acid |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)[C@H](SCC(=O)O)C[C@@H]12 |
| InChI | InChI=1S/C21H30O4S/c1-20-7-5-13(22)9-12(20)3-4-14-15(20)6-8-21(2)16(14)10-17(19(21)25)26-11-18(23)24/h3,13-17,22H,4-11H2,1-2H3,(H,23,24)/t13-,14+,15-,16-,17+,20-,21-/m0/s1 |
| InChIKey | SPGRBWYPJMFRFK-FBBQWMBLSA-N |
| XLogP | 3.68 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|