About 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one
2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one (PubChem CID 2325816) has the molecular formula C17H16N2O3S2
and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one |
| PubChem CID | 2325816 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one |
| SMILES | O=c1c2ccccc2sn1-c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H16N2O3S2/c20-17-15-5-1-2-6-16(15)23-19(17)13-7-9-14(10-8-13)24(21,22)18-11-3-4-12-18/h1-2,5-10H,3-4,11-12H2 |
| InChIKey | NDBAIHGDDWYLGY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one?
The IUPAC name of 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one (CID 2325816) is 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one?
The canonical SMILES for 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one is O=c1c2ccccc2sn1-c1ccc(S(=O)(=O)N2CCCC2)cc1.
What is the InChIKey of 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one?
The InChIKey is NDBAIHGDDWYLGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3S2/c20-17-15-5-1-2-6-16(15)23-19(17)13-7-9-14(10-8-13)24(21,22)18-11-3-4-12-18/h1-2,5-10H,3-4,11-12H2.
What are the key properties of 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one?
2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one has a molecular weight of 360.46 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-pyrrolidin-1-ylsulfonylphenyl)-1,2-benzothiazol-3-one is sourced from PubChem (CID 2325816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).