C15H24O2 — CID 23258358
1-[(1R,2R)-2-hydroxy-2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone (PubChem CID 23258358) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxy-2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-hydroxy-2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone |
|---|---|
| PubChem CID | 23258358 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxy-2,4,4-trimethyl-3-[(1E)-3-methylbuta-1,3-dienyl]cyclopentyl]ethanone |
| SMILES | C=C(C)/C=C/C1C(C)(C)C[C@@H](C(C)=O)[C@]1(C)O |
| InChI | InChI=1S/C15H24O2/c1-10(2)7-8-13-14(4,5)9-12(11(3)16)15(13,6)17/h7-8,12-13,17H,1,9H2,2-6H3/b8-7+/t12-,13?,15-/m0/s1 |
| InChIKey | ZXWQZBFXJGPNCY-CVMZXKLSSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|