C12H14O3 — CID 23258423
methyl (1S,8R)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate (PubChem CID 23258423) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl (1S,8R)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate.
| Compound Name | methyl (1S,8R)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate |
|---|---|
| PubChem CID | 23258423 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | methyl (1S,8R)-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate |
| SMILES | COC(=O)C1=CCC2=C(C1)[C@@H]1CC[C@H]2O1 |
| InChI | InChI=1S/C12H14O3/c1-14-12(13)7-2-3-8-9(6-7)11-5-4-10(8)15-11/h2,10-11H,3-6H2,1H3/t10-,11+/m1/s1 |
| InChIKey | FXMDBHFOKRXNFQ-MNOVXSKESA-N |
| XLogP | 1.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|