C14H14O3 — CID 23258425
methyl 9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate (PubChem CID 23258425) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate.
| Compound Name | methyl 9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate |
|---|---|
| PubChem CID | 23258425 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | methyl 9,10-dimethylidene-11-oxatricyclo[6.2.1.02,7]undeca-2(7),4-diene-4-carboxylate |
| SMILES | C=C1C(=C)C2OC1C1=C2CC(C(=O)OC)=CC1 |
| InChI | InChI=1S/C14H14O3/c1-7-8(2)13-11-6-9(14(15)16-3)4-5-10(11)12(7)17-13/h4,12-13H,1-2,5-6H2,3H3 |
| InChIKey | KYVATBCBYPNWCZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|