C15H20ClN — CID 23258696
(1R,2S,4aR,10bR)-1-chloro-2,4-dimethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline (PubChem CID 23258696) has the molecular formula C15H20ClN and a molecular weight of 249.78 g/mol. Its IUPAC name is (1R,2S,4aR,10bR)-1-chloro-2,4-dimethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline.
| Compound Name | (1R,2S,4aR,10bR)-1-chloro-2,4-dimethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline |
|---|---|
| PubChem CID | 23258696 |
| Molecular Formula | C15H20ClN |
| Molecular Weight | 249.78 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (1R,2S,4aR,10bR)-1-chloro-2,4-dimethyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline |
| SMILES | C[C@H]1CN(C)[C@@H]2CCc3ccccc3[C@H]2[C@@H]1Cl |
| InChI | InChI=1S/C15H20ClN/c1-10-9-17(2)13-8-7-11-5-3-4-6-12(11)14(13)15(10)16/h3-6,10,13-15H,7-9H2,1-2H3/t10-,13+,14+,15+/m0/s1 |
| InChIKey | OYYUCDVOXPOBPI-CJYSPXJISA-N |
| XLogP | 3.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|