C20H25NO10 — CID 23258772
[(2R,3S,4S,5R,6R)-3,5-diacetyloxy-6-hydroxy-4-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 23258772) has the molecular formula C20H25NO10 and a molecular weight of 439.42 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,5-diacetyloxy-6-hydroxy-4-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,5-diacetyloxy-6-hydroxy-4-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23258772 |
| Molecular Formula | C20H25NO10 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,5-diacetyloxy-6-hydroxy-4-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O)[C@H](OC(C)=O)[C@@H](NC(=O)OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO10/c1-11(22)27-10-15-17(29-12(2)23)16(18(19(25)31-15)30-13(3)24)21-20(26)28-9-14-7-5-4-6-8-14/h4-8,15-19,25H,9-10H2,1-3H3,(H,21,26)/t15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | QOXHTLNMUMPKIK-RHQZKXFESA-N |
| XLogP | 0.43 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|