C27H42O9S — CID 23259499
methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-7-oxo-12-sulfooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 23259499) has the molecular formula C27H42O9S and a molecular weight of 542.69 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-7-oxo-12-sulfooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-7-oxo-12-sulfooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 23259499 |
| Molecular Formula | C27H42O9S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | methyl (4R)-4-[(3R,5S,8R,9S,10S,12S,13R,14S,17R)-3-acetyloxy-10,13-dimethyl-7-oxo-12-sulfooxy-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(=O)C[C@@H]4C[C@H](OC(C)=O)CC[C@]4(C)[C@H]3C[C@H](OS(=O)(=O)O)[C@]12C |
| InChI | InChI=1S/C27H42O9S/c1-15(6-9-24(30)34-5)19-7-8-20-25-21(14-23(27(19,20)4)36-37(31,32)33)26(3)11-10-18(35-16(2)28)12-17(26)13-22(25)29/h15,17-21,23,25H,6-14H2,1-5H3,(H,31,32,33)/t15-,17+,18-,19-,20+,21+,23+,25+,26+,27-/m1/s1 |
| InChIKey | VUCJIPBZPFGCGF-RZNRKWMFSA-N |
| XLogP | 4.14 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|