C28H44O8S2 — CID 23259778
[(2R)-2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-(methylsulfanylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethenoxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 23259778) has the molecular formula C28H44O8S2 and a molecular weight of 572.79 g/mol. Its IUPAC name is [(2R)-2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-(methylsulfanylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethenoxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [(2R)-2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-(methylsulfanylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethenoxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 23259778 |
| Molecular Formula | C28H44O8S2 |
| Molecular Weight | 572.79 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | [(2R)-2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-(methylsulfanylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-ethenoxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | C=CO[C@H](COS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OCSC |
| InChI | InChI=1S/C28H44O8S2/c1-11-31-22(23-24(32-15-37-10)25-27(34-23)36-28(8,9)35-25)14-33-38(29,30)26-20(17(4)5)12-19(16(2)3)13-21(26)18(6)7/h11-13,16-18,22-25,27H,1,14-15H2,2-10H3/t22-,23-,24-,25-,27-/m1/s1 |
| InChIKey | OSHUCGPEHVMCCE-CXTGUETESA-N |
| XLogP | 5.87 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.79 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|