C24H33ClN2O3 — CID 23259826
(4S)-5,5-dibutyl-3-[(3S)-3-chlorobutanoyl]-4-(1H-indol-3-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 23259826) has the molecular formula C24H33ClN2O3 and a molecular weight of 432.99 g/mol. Its IUPAC name is (4S)-5,5-dibutyl-3-[(3S)-3-chlorobutanoyl]-4-(1H-indol-3-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-5,5-dibutyl-3-[(3S)-3-chlorobutanoyl]-4-(1H-indol-3-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23259826 |
| Molecular Formula | C24H33ClN2O3 |
| Molecular Weight | 432.99 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (4S)-5,5-dibutyl-3-[(3S)-3-chlorobutanoyl]-4-(1H-indol-3-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCC1(CCCC)OC(=O)N(C(=O)C[C@H](C)Cl)[C@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C24H33ClN2O3/c1-4-6-12-24(13-7-5-2)21(27(23(29)30-24)22(28)14-17(3)25)15-18-16-26-20-11-9-8-10-19(18)20/h8-11,16-17,21,26H,4-7,12-15H2,1-3H3/t17-,21-/m0/s1 |
| InChIKey | VVXGMGJTAOIIEB-UWJYYQICSA-N |
| XLogP | 6.19 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.99 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|